C14H14Cl2N2O4S2 — CID 8523597
N'-(2,5-dichlorophenyl)sulfonyl-2,5-dimethylbenzenesulfonohydrazide (PubChem CID 8523597) has the molecular formula C14H14Cl2N2O4S2 and a molecular weight of 409.32 g/mol. Its IUPAC name is N'-(2,5-dichlorophenyl)sulfonyl-2,5-dimethylbenzenesulfonohydrazide.
| Compound Name | N'-(2,5-dichlorophenyl)sulfonyl-2,5-dimethylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 8523597 |
| Molecular Formula | C14H14Cl2N2O4S2 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | N'-(2,5-dichlorophenyl)sulfonyl-2,5-dimethylbenzenesulfonohydrazide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NNS(=O)(=O)c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C14H14Cl2N2O4S2/c1-9-3-4-10(2)13(7-9)23(19,20)17-18-24(21,22)14-8-11(15)5-6-12(14)16/h3-8,17-18H,1-2H3 |
| InChIKey | IJUFALMFDFPBLH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|