C8H10ClN3O2S2 — CID 65214426
[(5-chloro-2-methylphenyl)sulfonylamino]thiourea (PubChem CID 65214426) has the molecular formula C8H10ClN3O2S2 and a molecular weight of 279.77 g/mol. Its IUPAC name is [(5-chloro-2-methylphenyl)sulfonylamino]thiourea.
| Compound Name | [(5-chloro-2-methylphenyl)sulfonylamino]thiourea |
|---|---|
| PubChem CID | 65214426 |
| Molecular Formula | C8H10ClN3O2S2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | [(5-chloro-2-methylphenyl)sulfonylamino]thiourea |
| SMILES | Cc1ccc(Cl)cc1S(=O)(=O)NNC(N)=S |
| InChI | InChI=1S/C8H10ClN3O2S2/c1-5-2-3-6(9)4-7(5)16(13,14)12-11-8(10)15/h2-4,12H,1H3,(H3,10,11,15) |
| InChIKey | MBUDWMOUTCHDAV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|