C9H12N4O3S2 — CID 65214372
5-[(carbamothioylamino)sulfamoyl]-2-methylbenzamide (PubChem CID 65214372) has the molecular formula C9H12N4O3S2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 5-[(carbamothioylamino)sulfamoyl]-2-methylbenzamide.
| Compound Name | 5-[(carbamothioylamino)sulfamoyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 65214372 |
| Molecular Formula | C9H12N4O3S2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 5-[(carbamothioylamino)sulfamoyl]-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(N)=S)cc1C(N)=O |
| InChI | InChI=1S/C9H12N4O3S2/c1-5-2-3-6(4-7(5)8(10)14)18(15,16)13-12-9(11)17/h2-4,13H,1H3,(H2,10,14)(H3,11,12,17) |
| InChIKey | OVVLTZGKTHGXHL-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|