C12H16N2O5S — CID 62675880
3-[(3-carbamoyl-4-methylphenyl)sulfonylamino]-2-methylpropanoic acid (PubChem CID 62675880) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is 3-[(3-carbamoyl-4-methylphenyl)sulfonylamino]-2-methylpropanoic acid.
| Compound Name | 3-[(3-carbamoyl-4-methylphenyl)sulfonylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 62675880 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 3-[(3-carbamoyl-4-methylphenyl)sulfonylamino]-2-methylpropanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NCC(C)C(=O)O)cc1C(N)=O |
| InChI | InChI=1S/C12H16N2O5S/c1-7-3-4-9(5-10(7)11(13)15)20(18,19)14-6-8(2)12(16)17/h3-5,8,14H,6H2,1-2H3,(H2,13,15)(H,16,17) |
| InChIKey | JBIPDFFEBZYHPU-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |