C15H15FN2O3S — CID 34033824
5-[(2-fluorophenyl)methylsulfamoyl]-2-methylbenzamide (PubChem CID 34033824) has the molecular formula C15H15FN2O3S and a molecular weight of 322.36 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)methylsulfamoyl]-2-methylbenzamide.
| Compound Name | 5-[(2-fluorophenyl)methylsulfamoyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 34033824 |
| Molecular Formula | C15H15FN2O3S |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 5-[(2-fluorophenyl)methylsulfamoyl]-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2ccccc2F)cc1C(N)=O |
| InChI | InChI=1S/C15H15FN2O3S/c1-10-6-7-12(8-13(10)15(17)19)22(20,21)18-9-11-4-2-3-5-14(11)16/h2-8,18H,9H2,1H3,(H2,17,19) |
| InChIKey | KUNHSXQOBLFEPU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |