C15H25N3O3S — CID 119985275
5-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]-2-methylbenzamide (PubChem CID 119985275) has the molecular formula C15H25N3O3S and a molecular weight of 327.45 g/mol. Its IUPAC name is 5-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]-2-methylbenzamide.
| Compound Name | 5-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 119985275 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 5-[(1-amino-2,4-dimethylpentan-2-yl)sulfamoyl]-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)(CN)CC(C)C)cc1C(N)=O |
| InChI | InChI=1S/C15H25N3O3S/c1-10(2)8-15(4,9-16)18-22(20,21)12-6-5-11(3)13(7-12)14(17)19/h5-7,10,18H,8-9,16H2,1-4H3,(H2,17,19) |
| InChIKey | RLQQPJHLENLQLW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |