C9H8Cl2N2O2 — CID 47099470
N'-acetyl-2,5-dichlorobenzohydrazide (PubChem CID 47099470) has the molecular formula C9H8Cl2N2O2 and a molecular weight of 247.08 g/mol. Its IUPAC name is N'-acetyl-2,5-dichlorobenzohydrazide.
| Compound Name | N'-acetyl-2,5-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 47099470 |
| Molecular Formula | C9H8Cl2N2O2 |
| Molecular Weight | 247.08 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | N'-acetyl-2,5-dichlorobenzohydrazide |
| SMILES | CC(=O)NNC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H8Cl2N2O2/c1-5(14)12-13-9(15)7-4-6(10)2-3-8(7)11/h2-4H,1H3,(H,12,14)(H,13,15) |
| InChIKey | WFJCRFNQHKOXJI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.08 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|