C9H11FN2O5S2 — CID 61217431
N'-(2-fluoro-5-methylsulfonylphenyl)sulfonylacetohydrazide (PubChem CID 61217431) has the molecular formula C9H11FN2O5S2 and a molecular weight of 310.33 g/mol. Its IUPAC name is N'-(2-fluoro-5-methylsulfonylphenyl)sulfonylacetohydrazide.
| Compound Name | N'-(2-fluoro-5-methylsulfonylphenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 61217431 |
| Molecular Formula | C9H11FN2O5S2 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | N'-(2-fluoro-5-methylsulfonylphenyl)sulfonylacetohydrazide |
| SMILES | CC(=O)NNS(=O)(=O)c1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C9H11FN2O5S2/c1-6(13)11-12-19(16,17)9-5-7(18(2,14)15)3-4-8(9)10/h3-5,12H,1-2H3,(H,11,13) |
| InChIKey | ZAEOEESEERPYGN-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|