C11H16FNO5S2 — CID 104868981
2-fluoro-N-[(2R)-1-hydroxybutan-2-yl]-5-methylsulfonylbenzenesulfonamide (PubChem CID 104868981) has the molecular formula C11H16FNO5S2 and a molecular weight of 325.38 g/mol. Its IUPAC name is 2-fluoro-N-[(2R)-1-hydroxybutan-2-yl]-5-methylsulfonylbenzenesulfonamide.
| Compound Name | 2-fluoro-N-[(2R)-1-hydroxybutan-2-yl]-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 104868981 |
| Molecular Formula | C11H16FNO5S2 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 2-fluoro-N-[(2R)-1-hydroxybutan-2-yl]-5-methylsulfonylbenzenesulfonamide |
| SMILES | CC[C@H](CO)NS(=O)(=O)c1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C11H16FNO5S2/c1-3-8(7-14)13-20(17,18)11-6-9(19(2,15)16)4-5-10(11)12/h4-6,8,13-14H,3,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | TXTMIZZTXMVDHM-MRVPVSSYSA-N |
| XLogP | 0.28 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |