C13H9Cl3N2O3S — CID 8616581
3-chloro-N'-(2,5-dichlorophenyl)sulfonylbenzohydrazide (PubChem CID 8616581) has the molecular formula C13H9Cl3N2O3S and a molecular weight of 379.65 g/mol. Its IUPAC name is 3-chloro-N'-(2,5-dichlorophenyl)sulfonylbenzohydrazide.
| Compound Name | 3-chloro-N'-(2,5-dichlorophenyl)sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 8616581 |
| Molecular Formula | C13H9Cl3N2O3S |
| Molecular Weight | 379.65 g/mol |
| Exact Mass | 377.94 |
| IUPAC Name | 3-chloro-N'-(2,5-dichlorophenyl)sulfonylbenzohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1cc(Cl)ccc1Cl)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H9Cl3N2O3S/c14-9-3-1-2-8(6-9)13(19)17-18-22(20,21)12-7-10(15)4-5-11(12)16/h1-7,18H,(H,17,19) |
| InChIKey | RYOYGTBNRWWMFK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.65 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|