C14H11ClN2O6S — CID 100820484
4-chloro-3-[[(4-hydroxybenzoyl)amino]sulfamoyl]benzoic acid (PubChem CID 100820484) has the molecular formula C14H11ClN2O6S and a molecular weight of 370.77 g/mol. Its IUPAC name is 4-chloro-3-[[(4-hydroxybenzoyl)amino]sulfamoyl]benzoic acid.
| Compound Name | 4-chloro-3-[[(4-hydroxybenzoyl)amino]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 100820484 |
| Molecular Formula | C14H11ClN2O6S |
| Molecular Weight | 370.77 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 4-chloro-3-[[(4-hydroxybenzoyl)amino]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(S(=O)(=O)NNC(=O)c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C14H11ClN2O6S/c15-11-6-3-9(14(20)21)7-12(11)24(22,23)17-16-13(19)8-1-4-10(18)5-2-8/h1-7,17-18H,(H,16,19)(H,20,21) |
| InChIKey | LEFSIEHKNZNPJM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.77 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|