C12H14ClNO5S2 — CID 104655249
4-chloro-3-[(1-oxothian-4-yl)sulfamoyl]benzoic acid (PubChem CID 104655249) has the molecular formula C12H14ClNO5S2 and a molecular weight of 351.83 g/mol. Its IUPAC name is 4-chloro-3-[(1-oxothian-4-yl)sulfamoyl]benzoic acid.
| Compound Name | 4-chloro-3-[(1-oxothian-4-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 104655249 |
| Molecular Formula | C12H14ClNO5S2 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 4-chloro-3-[(1-oxothian-4-yl)sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(S(=O)(=O)NC2CCS(=O)CC2)c1 |
| InChI | InChI=1S/C12H14ClNO5S2/c13-10-2-1-8(12(15)16)7-11(10)21(18,19)14-9-3-5-20(17)6-4-9/h1-2,7,9,14H,3-6H2,(H,15,16) |
| InChIKey | MTZWHYNZZDGAQY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |