C16H20ClNO5S — CID 23329158
4-[4-chloro-3-(cyclohexylsulfamoyl)phenyl]-4-oxobutanoic acid (PubChem CID 23329158) has the molecular formula C16H20ClNO5S and a molecular weight of 373.86 g/mol. Its IUPAC name is 4-[4-chloro-3-(cyclohexylsulfamoyl)phenyl]-4-oxobutanoic acid.
| Compound Name | 4-[4-chloro-3-(cyclohexylsulfamoyl)phenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 23329158 |
| Molecular Formula | C16H20ClNO5S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 4-[4-chloro-3-(cyclohexylsulfamoyl)phenyl]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)c1ccc(Cl)c(S(=O)(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C16H20ClNO5S/c17-13-7-6-11(14(19)8-9-16(20)21)10-15(13)24(22,23)18-12-4-2-1-3-5-12/h6-7,10,12,18H,1-5,8-9H2,(H,20,21) |
| InChIKey | YILUMQWGUOYYTQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |