C17H22ClNO5S — CID 69468983
4-[4-chloro-3-(cycloheptylsulfamoyl)phenyl]-4-oxobutanoic acid (PubChem CID 69468983) has the molecular formula C17H22ClNO5S and a molecular weight of 387.89 g/mol. Its IUPAC name is 4-[4-chloro-3-(cycloheptylsulfamoyl)phenyl]-4-oxobutanoic acid.
| Compound Name | 4-[4-chloro-3-(cycloheptylsulfamoyl)phenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 69468983 |
| Molecular Formula | C17H22ClNO5S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 4-[4-chloro-3-(cycloheptylsulfamoyl)phenyl]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)c1ccc(Cl)c(S(=O)(=O)NC2CCCCCC2)c1 |
| InChI | InChI=1S/C17H22ClNO5S/c18-14-8-7-12(15(20)9-10-17(21)22)11-16(14)25(23,24)19-13-5-3-1-2-4-6-13/h7-8,11,13,19H,1-6,9-10H2,(H,21,22) |
| InChIKey | NXYIFEJXBPZEFC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |