C11H12ClNO4S — CID 32917957
methyl 4-chloro-3-(cyclopropylsulfamoyl)benzoate (PubChem CID 32917957) has the molecular formula C11H12ClNO4S and a molecular weight of 289.74 g/mol. Its IUPAC name is methyl 4-chloro-3-(cyclopropylsulfamoyl)benzoate.
| Compound Name | methyl 4-chloro-3-(cyclopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 32917957 |
| Molecular Formula | C11H12ClNO4S |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | methyl 4-chloro-3-(cyclopropylsulfamoyl)benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C11H12ClNO4S/c1-17-11(14)7-2-5-9(12)10(6-7)18(15,16)13-8-3-4-8/h2,5-6,8,13H,3-4H2,1H3 |
| InChIKey | DHVSTWMHLHQTHY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |