C9H7ClF3NO5S — CID 82706951
4-chloro-3-(2,2,2-trifluoroethoxysulfamoyl)benzoic acid (PubChem CID 82706951) has the molecular formula C9H7ClF3NO5S and a molecular weight of 333.67 g/mol. Its IUPAC name is 4-chloro-3-(2,2,2-trifluoroethoxysulfamoyl)benzoic acid.
| Compound Name | 4-chloro-3-(2,2,2-trifluoroethoxysulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 82706951 |
| Molecular Formula | C9H7ClF3NO5S |
| Molecular Weight | 333.67 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | 4-chloro-3-(2,2,2-trifluoroethoxysulfamoyl)benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(S(=O)(=O)NOCC(F)(F)F)c1 |
| InChI | InChI=1S/C9H7ClF3NO5S/c10-6-2-1-5(8(15)16)3-7(6)20(17,18)14-19-4-9(11,12)13/h1-3,14H,4H2,(H,15,16) |
| InChIKey | PFPSFOOOGDAVPR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.67 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|