C11H12F3NO5S — CID 82712684
4-ethyl-3-(2,2,2-trifluoroethoxysulfamoyl)benzoic acid (PubChem CID 82712684) has the molecular formula C11H12F3NO5S and a molecular weight of 327.28 g/mol. Its IUPAC name is 4-ethyl-3-(2,2,2-trifluoroethoxysulfamoyl)benzoic acid.
| Compound Name | 4-ethyl-3-(2,2,2-trifluoroethoxysulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 82712684 |
| Molecular Formula | C11H12F3NO5S |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 4-ethyl-3-(2,2,2-trifluoroethoxysulfamoyl)benzoic acid |
| SMILES | CCc1ccc(C(=O)O)cc1S(=O)(=O)NOCC(F)(F)F |
| InChI | InChI=1S/C11H12F3NO5S/c1-2-7-3-4-8(10(16)17)5-9(7)21(18,19)15-20-6-11(12,13)14/h3-5,15H,2,6H2,1H3,(H,16,17) |
| InChIKey | VPKKIFNJYJLXRE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|