C10H10F3NO6S — CID 102695281
3-methoxy-4-(2,2,2-trifluoroethoxysulfamoyl)benzoic acid (PubChem CID 102695281) has the molecular formula C10H10F3NO6S and a molecular weight of 329.25 g/mol. Its IUPAC name is 3-methoxy-4-(2,2,2-trifluoroethoxysulfamoyl)benzoic acid.
| Compound Name | 3-methoxy-4-(2,2,2-trifluoroethoxysulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 102695281 |
| Molecular Formula | C10H10F3NO6S |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 3-methoxy-4-(2,2,2-trifluoroethoxysulfamoyl)benzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1S(=O)(=O)NOCC(F)(F)F |
| InChI | InChI=1S/C10H10F3NO6S/c1-19-7-4-6(9(15)16)2-3-8(7)21(17,18)14-20-5-10(11,12)13/h2-4,14H,5H2,1H3,(H,15,16) |
| InChIKey | NNFBSMBLWKGGJV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|