C9H11F3N2O5S — CID 82706668
1-ethyl-4-(2,2,2-trifluoroethoxysulfamoyl)pyrrole-2-carboxylic acid (PubChem CID 82706668) has the molecular formula C9H11F3N2O5S and a molecular weight of 316.26 g/mol. Its IUPAC name is 1-ethyl-4-(2,2,2-trifluoroethoxysulfamoyl)pyrrole-2-carboxylic acid.
| Compound Name | 1-ethyl-4-(2,2,2-trifluoroethoxysulfamoyl)pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 82706668 |
| Molecular Formula | C9H11F3N2O5S |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 1-ethyl-4-(2,2,2-trifluoroethoxysulfamoyl)pyrrole-2-carboxylic acid |
| SMILES | CCn1cc(S(=O)(=O)NOCC(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C9H11F3N2O5S/c1-2-14-4-6(3-7(14)8(15)16)20(17,18)13-19-5-9(10,11)12/h3-4,13H,2,5H2,1H3,(H,15,16) |
| InChIKey | ISIMVIZLUJXCDU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|