C11H16N2O6S — CID 60780498
1-ethyl-4-[(1-methoxy-1-oxopropan-2-yl)sulfamoyl]pyrrole-2-carboxylic acid (PubChem CID 60780498) has the molecular formula C11H16N2O6S and a molecular weight of 304.32 g/mol. Its IUPAC name is 1-ethyl-4-[(1-methoxy-1-oxopropan-2-yl)sulfamoyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-ethyl-4-[(1-methoxy-1-oxopropan-2-yl)sulfamoyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 60780498 |
| Molecular Formula | C11H16N2O6S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 1-ethyl-4-[(1-methoxy-1-oxopropan-2-yl)sulfamoyl]pyrrole-2-carboxylic acid |
| SMILES | CCn1cc(S(=O)(=O)NC(C)C(=O)OC)cc1C(=O)O |
| InChI | InChI=1S/C11H16N2O6S/c1-4-13-6-8(5-9(13)10(14)15)20(17,18)12-7(2)11(16)19-3/h5-7,12H,4H2,1-3H3,(H,14,15) |
| InChIKey | NAYNAHMXULBJFP-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |