C13H19NO6S — CID 79538518
3-(2,2-dimethoxyethylsulfamoyl)-4-ethylbenzoic acid (PubChem CID 79538518) has the molecular formula C13H19NO6S and a molecular weight of 317.36 g/mol. Its IUPAC name is 3-(2,2-dimethoxyethylsulfamoyl)-4-ethylbenzoic acid.
| Compound Name | 3-(2,2-dimethoxyethylsulfamoyl)-4-ethylbenzoic acid |
|---|---|
| PubChem CID | 79538518 |
| Molecular Formula | C13H19NO6S |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 3-(2,2-dimethoxyethylsulfamoyl)-4-ethylbenzoic acid |
| SMILES | CCc1ccc(C(=O)O)cc1S(=O)(=O)NCC(OC)OC |
| InChI | InChI=1S/C13H19NO6S/c1-4-9-5-6-10(13(15)16)7-11(9)21(17,18)14-8-12(19-2)20-3/h5-7,12,14H,4,8H2,1-3H3,(H,15,16) |
| InChIKey | MTUAJELGPLIZJR-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|