C12H17NO6S — CID 79548241
3-(2,2-dimethoxyethylsulfamoyl)-2-methylbenzoic acid (PubChem CID 79548241) has the molecular formula C12H17NO6S and a molecular weight of 303.34 g/mol. Its IUPAC name is 3-(2,2-dimethoxyethylsulfamoyl)-2-methylbenzoic acid.
| Compound Name | 3-(2,2-dimethoxyethylsulfamoyl)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 79548241 |
| Molecular Formula | C12H17NO6S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 3-(2,2-dimethoxyethylsulfamoyl)-2-methylbenzoic acid |
| SMILES | COC(CNS(=O)(=O)c1cccc(C(=O)O)c1C)OC |
| InChI | InChI=1S/C12H17NO6S/c1-8-9(12(14)15)5-4-6-10(8)20(16,17)13-7-11(18-2)19-3/h4-6,11,13H,7H2,1-3H3,(H,14,15) |
| InChIKey | GBEOPYXSAJJKLD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|