C12H17NO6S — CID 66186486
3-[(2,3-dihydroxy-2-methylpropyl)sulfamoyl]-2-methylbenzoic acid (PubChem CID 66186486) has the molecular formula C12H17NO6S and a molecular weight of 303.34 g/mol. Its IUPAC name is 3-[(2,3-dihydroxy-2-methylpropyl)sulfamoyl]-2-methylbenzoic acid.
| Compound Name | 3-[(2,3-dihydroxy-2-methylpropyl)sulfamoyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 66186486 |
| Molecular Formula | C12H17NO6S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 3-[(2,3-dihydroxy-2-methylpropyl)sulfamoyl]-2-methylbenzoic acid |
| SMILES | Cc1c(C(=O)O)cccc1S(=O)(=O)NCC(C)(O)CO |
| InChI | InChI=1S/C12H17NO6S/c1-8-9(11(15)16)4-3-5-10(8)20(18,19)13-6-12(2,17)7-14/h3-5,13-14,17H,6-7H2,1-2H3,(H,15,16) |
| InChIKey | YNXJFXXWHUUYSM-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |