C8H6BrClF3NO3S — CID 106605708
3-bromo-4-chloro-N-(2,2,2-trifluoroethoxy)benzenesulfonamide (PubChem CID 106605708) has the molecular formula C8H6BrClF3NO3S and a molecular weight of 368.56 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-(2,2,2-trifluoroethoxy)benzenesulfonamide.
| Compound Name | 3-bromo-4-chloro-N-(2,2,2-trifluoroethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 106605708 |
| Molecular Formula | C8H6BrClF3NO3S |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 366.89 |
| IUPAC Name | 3-bromo-4-chloro-N-(2,2,2-trifluoroethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(NOCC(F)(F)F)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C8H6BrClF3NO3S/c9-6-3-5(1-2-7(6)10)18(15,16)14-17-4-8(11,12)13/h1-3,14H,4H2 |
| InChIKey | FHMSIRDPPVGDCY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|