C12H14F3NO3S — CID 82715932
N-(2,2,2-trifluoroethoxy)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide (PubChem CID 82715932) has the molecular formula C12H14F3NO3S and a molecular weight of 309.31 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethoxy)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide.
| Compound Name | N-(2,2,2-trifluoroethoxy)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 82715932 |
| Molecular Formula | C12H14F3NO3S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | N-(2,2,2-trifluoroethoxy)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NOCC(F)(F)F)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C12H14F3NO3S/c13-12(14,15)8-19-16-20(17,18)11-6-5-9-3-1-2-4-10(9)7-11/h5-7,16H,1-4,8H2 |
| InChIKey | XQLJFXLAUGQUJO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|