C11H10F3NO5S — CID 82712506
(E)-3-[4-(2,2,2-trifluoroethoxysulfamoyl)phenyl]prop-2-enoic acid (PubChem CID 82712506) has the molecular formula C11H10F3NO5S and a molecular weight of 325.26 g/mol. Its IUPAC name is (E)-3-[4-(2,2,2-trifluoroethoxysulfamoyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(2,2,2-trifluoroethoxysulfamoyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82712506 |
| Molecular Formula | C11H10F3NO5S |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | (E)-3-[4-(2,2,2-trifluoroethoxysulfamoyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(S(=O)(=O)NOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H10F3NO5S/c12-11(13,14)7-20-15-21(18,19)9-4-1-8(2-5-9)3-6-10(16)17/h1-6,15H,7H2,(H,16,17)/b6-3+ |
| InChIKey | ZBDQJWKTWVOHCQ-ZZXKWVIFSA-N |
| XLogP | 1.56 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|