C11H11F2NO4S — CID 115405541
(E)-3-[4-(2,2-difluoroethylsulfamoyl)phenyl]prop-2-enoic acid (PubChem CID 115405541) has the molecular formula C11H11F2NO4S and a molecular weight of 291.28 g/mol. Its IUPAC name is (E)-3-[4-(2,2-difluoroethylsulfamoyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(2,2-difluoroethylsulfamoyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115405541 |
| Molecular Formula | C11H11F2NO4S |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | (E)-3-[4-(2,2-difluoroethylsulfamoyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(S(=O)(=O)NCC(F)F)cc1 |
| InChI | InChI=1S/C11H11F2NO4S/c12-10(13)7-14-19(17,18)9-4-1-8(2-5-9)3-6-11(15)16/h1-6,10,14H,7H2,(H,15,16)/b6-3+ |
| InChIKey | ROOLDAMETUTXJV-ZZXKWVIFSA-N |
| XLogP | 1.33 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|