C12H15N3O5S — CID 83112109
(E)-3-[4-[2-(carbamoylamino)ethylsulfamoyl]phenyl]prop-2-enoic acid (PubChem CID 83112109) has the molecular formula C12H15N3O5S and a molecular weight of 313.34 g/mol. Its IUPAC name is (E)-3-[4-[2-(carbamoylamino)ethylsulfamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-(carbamoylamino)ethylsulfamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 83112109 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (E)-3-[4-[2-(carbamoylamino)ethylsulfamoyl]phenyl]prop-2-enoic acid |
| SMILES | NC(=O)NCCNS(=O)(=O)c1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C12H15N3O5S/c13-12(18)14-7-8-15-21(19,20)10-4-1-9(2-5-10)3-6-11(16)17/h1-6,15H,7-8H2,(H,16,17)(H3,13,14,18)/b6-3+ |
| InChIKey | AUXJJSZJZKXMFQ-ZZXKWVIFSA-N |
| XLogP | -0.27 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|