C13H17NO6S — CID 77114458
3-[4-[(2,3-dihydroxy-2-methylpropyl)sulfamoyl]phenyl]prop-2-enoic acid (PubChem CID 77114458) has the molecular formula C13H17NO6S and a molecular weight of 315.35 g/mol. Its IUPAC name is 3-[4-[(2,3-dihydroxy-2-methylpropyl)sulfamoyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[(2,3-dihydroxy-2-methylpropyl)sulfamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77114458 |
| Molecular Formula | C13H17NO6S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 3-[4-[(2,3-dihydroxy-2-methylpropyl)sulfamoyl]phenyl]prop-2-enoic acid |
| SMILES | CC(O)(CO)CNS(=O)(=O)c1ccc(C=CC(=O)O)cc1 |
| InChI | InChI=1S/C13H17NO6S/c1-13(18,9-15)8-14-21(19,20)11-5-2-10(3-6-11)4-7-12(16)17/h2-7,14-15,18H,8-9H2,1H3,(H,16,17) |
| InChIKey | JJFIWRVPOKOJOX-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|