C11H17NO3S — CID 115362987
N-(3-hydroxy-2,2-dimethylpropyl)benzenesulfonamide (PubChem CID 115362987) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is N-(3-hydroxy-2,2-dimethylpropyl)benzenesulfonamide.
| Compound Name | N-(3-hydroxy-2,2-dimethylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115362987 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-(3-hydroxy-2,2-dimethylpropyl)benzenesulfonamide |
| SMILES | CC(C)(CO)CNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H17NO3S/c1-11(2,9-13)8-12-16(14,15)10-6-4-3-5-7-10/h3-7,12-13H,8-9H2,1-2H3 |
| InChIKey | DJGDLEIWHYCLQR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |