C9H16N2O3S — CID 115363011
N-(3-hydroxy-2,2-dimethylpropyl)-1H-pyrrole-3-sulfonamide (PubChem CID 115363011) has the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. Its IUPAC name is N-(3-hydroxy-2,2-dimethylpropyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | N-(3-hydroxy-2,2-dimethylpropyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 115363011 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | N-(3-hydroxy-2,2-dimethylpropyl)-1H-pyrrole-3-sulfonamide |
| SMILES | CC(C)(CO)CNS(=O)(=O)c1cc[nH]c1 |
| InChI | InChI=1S/C9H16N2O3S/c1-9(2,7-12)6-11-15(13,14)8-3-4-10-5-8/h3-5,10-12H,6-7H2,1-2H3 |
| InChIKey | PSZFIMZTHVMFSQ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |