C15H25NO3S — CID 115362965
4-tert-butyl-N-(3-hydroxy-2,2-dimethylpropyl)benzenesulfonamide (PubChem CID 115362965) has the molecular formula C15H25NO3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 4-tert-butyl-N-(3-hydroxy-2,2-dimethylpropyl)benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-(3-hydroxy-2,2-dimethylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115362965 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 4-tert-butyl-N-(3-hydroxy-2,2-dimethylpropyl)benzenesulfonamide |
| SMILES | CC(C)(CO)CNS(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H25NO3S/c1-14(2,3)12-6-8-13(9-7-12)20(18,19)16-10-15(4,5)11-17/h6-9,16-17H,10-11H2,1-5H3 |
| InChIKey | DMPARIKBVMJGMK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |