C14H19NO5S — CID 115358296
(E)-3-[4-[(3-hydroxy-2,2-dimethylpropyl)sulfamoyl]phenyl]prop-2-enoic acid (PubChem CID 115358296) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is (E)-3-[4-[(3-hydroxy-2,2-dimethylpropyl)sulfamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(3-hydroxy-2,2-dimethylpropyl)sulfamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115358296 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (E)-3-[4-[(3-hydroxy-2,2-dimethylpropyl)sulfamoyl]phenyl]prop-2-enoic acid |
| SMILES | CC(C)(CO)CNS(=O)(=O)c1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C14H19NO5S/c1-14(2,10-16)9-15-21(19,20)12-6-3-11(4-7-12)5-8-13(17)18/h3-8,15-16H,9-10H2,1-2H3,(H,17,18)/b8-5+ |
| InChIKey | DNVALYDCMFOLQN-VMPITWQZSA-N |
| XLogP | 1.08 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|