C10H18N2O3S — CID 106143797
N-(4-hydroxy-2,2-dimethylbutyl)-1H-pyrrole-3-sulfonamide (PubChem CID 106143797) has the molecular formula C10H18N2O3S and a molecular weight of 246.33 g/mol. Its IUPAC name is N-(4-hydroxy-2,2-dimethylbutyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | N-(4-hydroxy-2,2-dimethylbutyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106143797 |
| Molecular Formula | C10H18N2O3S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-(4-hydroxy-2,2-dimethylbutyl)-1H-pyrrole-3-sulfonamide |
| SMILES | CC(C)(CCO)CNS(=O)(=O)c1cc[nH]c1 |
| InChI | InChI=1S/C10H18N2O3S/c1-10(2,4-6-13)8-12-16(14,15)9-3-5-11-7-9/h3,5,7,11-13H,4,6,8H2,1-2H3 |
| InChIKey | RXNKVGIHFPJDFL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |