C10H19N3O3S — CID 113347933
N-(5-hydroxy-2,2-dimethylpentyl)-1H-pyrazole-4-sulfonamide (PubChem CID 113347933) has the molecular formula C10H19N3O3S and a molecular weight of 261.35 g/mol. Its IUPAC name is N-(5-hydroxy-2,2-dimethylpentyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(5-hydroxy-2,2-dimethylpentyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 113347933 |
| Molecular Formula | C10H19N3O3S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-(5-hydroxy-2,2-dimethylpentyl)-1H-pyrazole-4-sulfonamide |
| SMILES | CC(C)(CCCO)CNS(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C10H19N3O3S/c1-10(2,4-3-5-14)8-13-17(15,16)9-6-11-12-7-9/h6-7,13-14H,3-5,8H2,1-2H3,(H,11,12) |
| InChIKey | VZRGFNFTRZIFAK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |