C7H13N3O2S — CID 47267365
N-tert-butyl-1H-pyrazole-4-sulfonamide (PubChem CID 47267365) has the molecular formula C7H13N3O2S and a molecular weight of 203.27 g/mol. Its IUPAC name is N-tert-butyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-tert-butyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 47267365 |
| Molecular Formula | C7H13N3O2S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | N-tert-butyl-1H-pyrazole-4-sulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C7H13N3O2S/c1-7(2,3)10-13(11,12)6-4-8-9-5-6/h4-5,10H,1-3H3,(H,8,9) |
| InChIKey | SVBZGXVFFBCJNV-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |