C9H18N4O2S — CID 115310721
N-(1-amino-2,3-dimethylbutan-2-yl)-1H-pyrazole-4-sulfonamide (PubChem CID 115310721) has the molecular formula C9H18N4O2S and a molecular weight of 246.34 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 115310721 |
| Molecular Formula | C9H18N4O2S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)-1H-pyrazole-4-sulfonamide |
| SMILES | CC(C)C(C)(CN)NS(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C9H18N4O2S/c1-7(2)9(3,6-10)13-16(14,15)8-4-11-12-5-8/h4-5,7,13H,6,10H2,1-3H3,(H,11,12) |
| InChIKey | XSPAPAKJQYHXMN-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |