C12H18N4O2S — CID 114614909
N-(1-amino-2,3-dimethylbutan-2-yl)-6-cyanopyridine-3-sulfonamide (PubChem CID 114614909) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)-6-cyanopyridine-3-sulfonamide.
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)-6-cyanopyridine-3-sulfonamide |
|---|---|
| PubChem CID | 114614909 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)-6-cyanopyridine-3-sulfonamide |
| SMILES | CC(C)C(C)(CN)NS(=O)(=O)c1ccc(C#N)nc1 |
| InChI | InChI=1S/C12H18N4O2S/c1-9(2)12(3,8-14)16-19(17,18)11-5-4-10(6-13)15-7-11/h4-5,7,9,16H,8,14H2,1-3H3 |
| InChIKey | FBFYAAQDWFFGAC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |