C11H14N4O2S — CID 115752512
N-(2-amino-1-cyclopropylethyl)-6-cyanopyridine-3-sulfonamide (PubChem CID 115752512) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-6-cyanopyridine-3-sulfonamide.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-6-cyanopyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115752512 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-6-cyanopyridine-3-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NC(CN)C2CC2)cn1 |
| InChI | InChI=1S/C11H14N4O2S/c12-5-9-3-4-10(7-14-9)18(16,17)15-11(6-13)8-1-2-8/h3-4,7-8,11,15H,1-2,6,13H2 |
| InChIKey | RZWUYPPJBQXQKQ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |