C14H19N3O2S — CID 47363914
N-[1-(4-propan-2-ylphenyl)ethyl]-1H-pyrazole-4-sulfonamide (PubChem CID 47363914) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is N-[1-(4-propan-2-ylphenyl)ethyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[1-(4-propan-2-ylphenyl)ethyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 47363914 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-[1-(4-propan-2-ylphenyl)ethyl]-1H-pyrazole-4-sulfonamide |
| SMILES | CC(C)c1ccc(C(C)NS(=O)(=O)c2cn[nH]c2)cc1 |
| InChI | InChI=1S/C14H19N3O2S/c1-10(2)12-4-6-13(7-5-12)11(3)17-20(18,19)14-8-15-16-9-14/h4-11,17H,1-3H3,(H,15,16) |
| InChIKey | RIWBYIMTUHXEAP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |