C11H11F2N3O2S — CID 103854165
3,4-difluoro-N-[1-(1H-pyrazol-4-yl)ethyl]benzenesulfonamide (PubChem CID 103854165) has the molecular formula C11H11F2N3O2S and a molecular weight of 287.29 g/mol. Its IUPAC name is 3,4-difluoro-N-[1-(1H-pyrazol-4-yl)ethyl]benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-[1-(1H-pyrazol-4-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 103854165 |
| Molecular Formula | C11H11F2N3O2S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 3,4-difluoro-N-[1-(1H-pyrazol-4-yl)ethyl]benzenesulfonamide |
| SMILES | CC(NS(=O)(=O)c1ccc(F)c(F)c1)c1cn[nH]c1 |
| InChI | InChI=1S/C11H11F2N3O2S/c1-7(8-5-14-15-6-8)16-19(17,18)9-2-3-10(12)11(13)4-9/h2-7,16H,1H3,(H,14,15) |
| InChIKey | UOTQJPXZMUBDGN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |