C12H12IN3O4S — CID 106208885
2-iodo-5-[1-(1H-pyrazol-4-yl)ethylsulfamoyl]benzoic acid (PubChem CID 106208885) has the molecular formula C12H12IN3O4S and a molecular weight of 421.22 g/mol. Its IUPAC name is 2-iodo-5-[1-(1H-pyrazol-4-yl)ethylsulfamoyl]benzoic acid.
| Compound Name | 2-iodo-5-[1-(1H-pyrazol-4-yl)ethylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 106208885 |
| Molecular Formula | C12H12IN3O4S |
| Molecular Weight | 421.22 g/mol |
| Exact Mass | 420.96 |
| IUPAC Name | 2-iodo-5-[1-(1H-pyrazol-4-yl)ethylsulfamoyl]benzoic acid |
| SMILES | CC(NS(=O)(=O)c1ccc(I)c(C(=O)O)c1)c1cn[nH]c1 |
| InChI | InChI=1S/C12H12IN3O4S/c1-7(8-5-14-15-6-8)16-21(19,20)9-2-3-11(13)10(4-9)12(17)18/h2-7,16H,1H3,(H,14,15)(H,17,18) |
| InChIKey | CECARYXARCKZJJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|