C13H17N3O2S — CID 54867726
N-[1-(2,4-dimethylphenyl)ethyl]-1H-pyrazole-4-sulfonamide (PubChem CID 54867726) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is N-[1-(2,4-dimethylphenyl)ethyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[1-(2,4-dimethylphenyl)ethyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 54867726 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-[1-(2,4-dimethylphenyl)ethyl]-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1ccc(C(C)NS(=O)(=O)c2cn[nH]c2)c(C)c1 |
| InChI | InChI=1S/C13H17N3O2S/c1-9-4-5-13(10(2)6-9)11(3)16-19(17,18)12-7-14-15-8-12/h4-8,11,16H,1-3H3,(H,14,15) |
| InChIKey | XXNJRLGSXZTIGA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |