C14H24N2O3S — CID 106144652
N-ethyl-4-[(4-hydroxy-2,2-dimethylbutyl)amino]benzenesulfonamide (PubChem CID 106144652) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is N-ethyl-4-[(4-hydroxy-2,2-dimethylbutyl)amino]benzenesulfonamide.
| Compound Name | N-ethyl-4-[(4-hydroxy-2,2-dimethylbutyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 106144652 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | N-ethyl-4-[(4-hydroxy-2,2-dimethylbutyl)amino]benzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(NCC(C)(C)CCO)cc1 |
| InChI | InChI=1S/C14H24N2O3S/c1-4-16-20(18,19)13-7-5-12(6-8-13)15-11-14(2,3)9-10-17/h5-8,15-17H,4,9-11H2,1-3H3 |
| InChIKey | BSHIJIOPZCVBMB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |