C11H17N3O4S — CID 106171016
3-[4-(ethylsulfamoyl)anilino]-2-hydroxypropanamide (PubChem CID 106171016) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is 3-[4-(ethylsulfamoyl)anilino]-2-hydroxypropanamide.
| Compound Name | 3-[4-(ethylsulfamoyl)anilino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106171016 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3-[4-(ethylsulfamoyl)anilino]-2-hydroxypropanamide |
| SMILES | CCNS(=O)(=O)c1ccc(NCC(O)C(N)=O)cc1 |
| InChI | InChI=1S/C11H17N3O4S/c1-2-14-19(17,18)9-5-3-8(4-6-9)13-7-10(15)11(12)16/h3-6,10,13-15H,2,7H2,1H3,(H2,12,16) |
| InChIKey | LEUMBDHBYHKIPL-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |