C14H25N3O3S — CID 106145672
4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-N-ethylbenzenesulfonamide (PubChem CID 106145672) has the molecular formula C14H25N3O3S and a molecular weight of 315.44 g/mol. Its IUPAC name is 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-N-ethylbenzenesulfonamide.
| Compound Name | 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106145672 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]-N-ethylbenzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(NCC(C)(O)CN(C)C)cc1 |
| InChI | InChI=1S/C14H25N3O3S/c1-5-16-21(19,20)13-8-6-12(7-9-13)15-10-14(2,18)11-17(3)4/h6-9,15-16,18H,5,10-11H2,1-4H3 |
| InChIKey | MVFZOUIIBNBSIK-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |