C13H21N3O4S — CID 103838120
4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]sulfamoyl]benzamide (PubChem CID 103838120) has the molecular formula C13H21N3O4S and a molecular weight of 315.39 g/mol. Its IUPAC name is 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]sulfamoyl]benzamide.
| Compound Name | 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 103838120 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]sulfamoyl]benzamide |
| SMILES | CN(C)CC(C)(O)CNS(=O)(=O)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C13H21N3O4S/c1-13(18,9-16(2)3)8-15-21(19,20)11-6-4-10(5-7-11)12(14)17/h4-7,15,18H,8-9H2,1-3H3,(H2,14,17) |
| InChIKey | GHCWWIHDEPKXED-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |