C13H22N4O2 — CID 106141828
3-amino-4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]benzamide (PubChem CID 106141828) has the molecular formula C13H22N4O2 and a molecular weight of 266.35 g/mol. Its IUPAC name is 3-amino-4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]benzamide.
| Compound Name | 3-amino-4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]benzamide |
|---|---|
| PubChem CID | 106141828 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 3-amino-4-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]amino]benzamide |
| SMILES | CN(C)CC(C)(O)CNc1ccc(C(N)=O)cc1N |
| InChI | InChI=1S/C13H22N4O2/c1-13(19,8-17(2)3)7-16-11-5-4-9(12(15)18)6-10(11)14/h4-6,16,19H,7-8,14H2,1-3H3,(H2,15,18) |
| InChIKey | VBQHVAPGRJGSCL-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|