C16H28N4O — CID 82993299
3-amino-4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-N-ethylbenzamide (PubChem CID 82993299) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is 3-amino-4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-N-ethylbenzamide.
| Compound Name | 3-amino-4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 82993299 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 3-amino-4-[[3-(dimethylamino)-2,2-dimethylpropyl]amino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(NCC(C)(C)CN(C)C)c(N)c1 |
| InChI | InChI=1S/C16H28N4O/c1-6-18-15(21)12-7-8-14(13(17)9-12)19-10-16(2,3)11-20(4)5/h7-9,19H,6,10-11,17H2,1-5H3,(H,18,21) |
| InChIKey | CBJDQJUUGZPDFM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|