C11H18N2O5S2 — CID 106142997
5-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]sulfamoyl]thiophene-3-carboxylic acid (PubChem CID 106142997) has the molecular formula C11H18N2O5S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 5-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]sulfamoyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]sulfamoyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 106142997 |
| Molecular Formula | C11H18N2O5S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 5-[[3-(dimethylamino)-2-hydroxy-2-methylpropyl]sulfamoyl]thiophene-3-carboxylic acid |
| SMILES | CN(C)CC(C)(O)CNS(=O)(=O)c1cc(C(=O)O)cs1 |
| InChI | InChI=1S/C11H18N2O5S2/c1-11(16,7-13(2)3)6-12-20(17,18)9-4-8(5-19-9)10(14)15/h4-5,12,16H,6-7H2,1-3H3,(H,14,15) |
| InChIKey | FGLXXQSVVOINKG-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |